C13H22Si2 — CID 154091967
[2-(2,3,4,5,6-pentamethylphenyl)-1-silylethenyl]silane (PubChem CID 154091967) has the molecular formula C13H22Si2 and a molecular weight of 234.49 g/mol. Its IUPAC name is [2-(2,3,4,5,6-pentamethylphenyl)-1-silylethenyl]silane.
| Compound Name | [2-(2,3,4,5,6-pentamethylphenyl)-1-silylethenyl]silane |
|---|---|
| PubChem CID | 154091967 |
| Molecular Formula | C13H22Si2 |
| Molecular Weight | 234.49 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | [2-(2,3,4,5,6-pentamethylphenyl)-1-silylethenyl]silane |
| SMILES | Cc1c(C)c(C)c(C=C([SiH3])[SiH3])c(C)c1C |
| InChI | InChI=1S/C13H22Si2/c1-7-8(2)10(4)12(6-13(14)15)11(5)9(7)3/h6H,1-5,14-15H3 |
| InChIKey | JMGVKSNVCIHNRN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.49 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|