C60H82O4 — CID 91486771
2,3,4,5,6,7,8-heptamethylnaphthalene-1-carbaldehyde;(1,3,4,5,6,7,8-heptamethylnaphthalen-2-yl)methanol;bis((2,3,4,5,6-pentamethylphenyl)methanol) (PubChem CID 91486771) has the molecular formula C60H82O4 and a molecular weight of 867.31 g/mol. Its IUPAC name is 2,3,4,5,6,7,8-heptamethylnaphthalene-1-carbaldehyde;(1,3,4,5,6,7,8-heptamethylnaphthalen-2-yl)methanol;bis((2,3,4,5,6-pentamethylphenyl)methanol).
| Compound Name | 2,3,4,5,6,7,8-heptamethylnaphthalene-1-carbaldehyde;(1,3,4,5,6,7,8-heptamethylnaphthalen-2-yl)methanol;bis((2,3,4,5,6-pentamethylphenyl)methanol) |
|---|---|
| PubChem CID | 91486771 |
| Molecular Formula | C60H82O4 |
| Molecular Weight | 867.31 g/mol |
| Exact Mass | 866.62 |
| IUPAC Name | 2,3,4,5,6,7,8-heptamethylnaphthalene-1-carbaldehyde;(1,3,4,5,6,7,8-heptamethylnaphthalen-2-yl)methanol;bis((2,3,4,5,6-pentamethylphenyl)methanol) |
| SMILES | Cc1c(C)c(C)c(CO)c(C)c1C.Cc1c(C)c(C)c(CO)c(C)c1C.Cc1c(C)c(C)c2c(C)c(CO)c(C)c(C)c2c1C.Cc1c(C)c(C)c2c(C=O)c(C)c(C)c(C)c2c1C |
| InChI | InChI=1S/C18H22O.C18H24O.2C12H18O/c1-9-10(2)15(7)18-16(8-19)12(4)11(3)14(6)17(18)13(9)5;1-9-10(2)13(5)18-15(7)16(8-19)11(3)14(6)17(18)12(9)4;2*1-7-8(2)10(4)12(6-13)11(5)9(7)3/h8H,1-7H3;19H,8H2,1-7H3;2*13H,6H2,1-5H3 |
| InChIKey | UJAYRQBVLKFVHP-UHFFFAOYSA-N |
| XLogP | 14.74 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.31 |
| LogP ≤ 5 | 14.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|