C25H22O5 — CID 143250816
7,8-diformyl-10-hydroxy-1,2,3,5,6,9-hexamethylpyrene-4-carboxylic acid (PubChem CID 143250816) has the molecular formula C25H22O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is 7,8-diformyl-10-hydroxy-1,2,3,5,6,9-hexamethylpyrene-4-carboxylic acid.
| Compound Name | 7,8-diformyl-10-hydroxy-1,2,3,5,6,9-hexamethylpyrene-4-carboxylic acid |
|---|---|
| PubChem CID | 143250816 |
| Molecular Formula | C25H22O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 7,8-diformyl-10-hydroxy-1,2,3,5,6,9-hexamethylpyrene-4-carboxylic acid |
| SMILES | Cc1c(C)c2c(O)c(C)c3c(C=O)c(C=O)c(C)c4c(C)c(C(=O)O)c(c1C)c2c43 |
| InChI | InChI=1S/C25H22O5/c1-9-10(2)19-21(25(29)30)13(5)17-12(4)15(7-26)16(8-27)18-14(6)24(28)20(11(9)3)23(19)22(17)18/h7-8,28H,1-6H3,(H,29,30) |
| InChIKey | VMSPNCOGUVBXIA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|