C22H26O2 — CID 160643679
1,2,3,4,5,6,7,8-octamethylphenanthrene-9,10-diol (PubChem CID 160643679) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octamethylphenanthrene-9,10-diol.
| Compound Name | 1,2,3,4,5,6,7,8-octamethylphenanthrene-9,10-diol |
|---|---|
| PubChem CID | 160643679 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octamethylphenanthrene-9,10-diol |
| SMILES | Cc1c(C)c(C)c2c(c1C)c(O)c(O)c1c(C)c(C)c(C)c(C)c12 |
| InChI | InChI=1S/C22H26O2/c1-9-11(3)15(7)19-17(13(9)5)18-14(6)10(2)12(4)16(8)20(18)22(24)21(19)23/h23-24H,1-8H3 |
| InChIKey | VZVKYSOTWXFOEI-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|