C16H20O — CID 20665127
3,4,5,6,7,8-hexamethylnaphthalen-1-ol (PubChem CID 20665127) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is 3,4,5,6,7,8-hexamethylnaphthalen-1-ol.
| Compound Name | 3,4,5,6,7,8-hexamethylnaphthalen-1-ol |
|---|---|
| PubChem CID | 20665127 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 3,4,5,6,7,8-hexamethylnaphthalen-1-ol |
| SMILES | Cc1cc(O)c2c(C)c(C)c(C)c(C)c2c1C |
| InChI | InChI=1S/C16H20O/c1-8-7-14(17)16-13(6)11(4)10(3)12(5)15(16)9(8)2/h7,17H,1-6H3 |
| InChIKey | YAWZNHZTDKFSSD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |