C9H12Ac2O2 — CID 22949987
actinium;2,3,5-trimethylbenzene-1,4-diol (PubChem CID 22949987) has the molecular formula C9H12Ac2O2 and a molecular weight of 606.19 g/mol. Its IUPAC name is actinium;2,3,5-trimethylbenzene-1,4-diol.
| Compound Name | actinium;2,3,5-trimethylbenzene-1,4-diol |
|---|---|
| PubChem CID | 22949987 |
| Molecular Formula | C9H12Ac2O2 |
| Molecular Weight | 606.19 g/mol |
| Exact Mass | 606.14 |
| IUPAC Name | actinium;2,3,5-trimethylbenzene-1,4-diol |
| SMILES | Cc1cc(O)c(C)c(C)c1O.[Ac].[Ac] |
| InChI | InChI=1S/C9H12O2.2Ac/c1-5-4-8(10)6(2)7(3)9(5)11;;/h4,10-11H,1-3H3;; |
| InChIKey | LJKBPLMLBHVEPK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.19 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|