C12H18O2 — CID 58864787
3-tert-butyl-2,5-dimethylbenzene-1,4-diol (PubChem CID 58864787) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 3-tert-butyl-2,5-dimethylbenzene-1,4-diol.
| Compound Name | 3-tert-butyl-2,5-dimethylbenzene-1,4-diol |
|---|---|
| PubChem CID | 58864787 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3-tert-butyl-2,5-dimethylbenzene-1,4-diol |
| SMILES | Cc1cc(O)c(C)c(C(C)(C)C)c1O |
| InChI | InChI=1S/C12H18O2/c1-7-6-9(13)8(2)10(11(7)14)12(3,4)5/h6,13-14H,1-5H3 |
| InChIKey | YEPOZMNWUDLCGZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|