About 3-tert-butyl-2,5-dimethylbenzene-1,4-diol
3-tert-butyl-2,5-dimethylbenzene-1,4-diol (PubChem CID 58864787) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 3-tert-butyl-2,5-dimethylbenzene-1,4-diol.
Molecular Properties
| Compound Name | 3-tert-butyl-2,5-dimethylbenzene-1,4-diol |
| PubChem CID | 58864787 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3-tert-butyl-2,5-dimethylbenzene-1,4-diol |
| SMILES | Cc1cc(O)c(C)c(C(C)(C)C)c1O |
| InChI | InChI=1S/C12H18O2/c1-7-6-9(13)8(2)10(11(7)14)12(3,4)5/h6,13-14H,1-5H3 |
| InChIKey | YEPOZMNWUDLCGZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-2,5-dimethylbenzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2,5-dimethylbenzene-1,4-diol?
The IUPAC name of 3-tert-butyl-2,5-dimethylbenzene-1,4-diol (CID 58864787) is 3-tert-butyl-2,5-dimethylbenzene-1,4-diol.
What is the SMILES notation for 3-tert-butyl-2,5-dimethylbenzene-1,4-diol?
The canonical SMILES for 3-tert-butyl-2,5-dimethylbenzene-1,4-diol is Cc1cc(O)c(C)c(C(C)(C)C)c1O.
What is the InChIKey of 3-tert-butyl-2,5-dimethylbenzene-1,4-diol?
The InChIKey is YEPOZMNWUDLCGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-7-6-9(13)8(2)10(11(7)14)12(3,4)5/h6,13-14H,1-5H3.
What are the key properties of 3-tert-butyl-2,5-dimethylbenzene-1,4-diol?
3-tert-butyl-2,5-dimethylbenzene-1,4-diol has a molecular weight of 194.27 g/mol, XLogP of 3.01, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2,5-dimethylbenzene-1,4-diol is sourced from PubChem (CID 58864787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).