C9H12O3 — CID 87355604
5-(hydroxymethyl)-2,3-dimethylbenzene-1,4-diol (PubChem CID 87355604) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2,3-dimethylbenzene-1,4-diol.
| Compound Name | 5-(hydroxymethyl)-2,3-dimethylbenzene-1,4-diol |
|---|---|
| PubChem CID | 87355604 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 5-(hydroxymethyl)-2,3-dimethylbenzene-1,4-diol |
| SMILES | Cc1c(O)cc(CO)c(O)c1C |
| InChI | InChI=1S/C9H12O3/c1-5-6(2)9(12)7(4-10)3-8(5)11/h3,10-12H,4H2,1-2H3 |
| InChIKey | HRGLVAYFJXEWJL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|