C12H12O — CID 15915434
3,4-dimethylnaphthalen-1-ol (PubChem CID 15915434) has the molecular formula C12H12O and a molecular weight of 172.23 g/mol. Its IUPAC name is 3,4-dimethylnaphthalen-1-ol.
| Compound Name | 3,4-dimethylnaphthalen-1-ol |
|---|---|
| PubChem CID | 15915434 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 3,4-dimethylnaphthalen-1-ol |
| SMILES | Cc1cc(O)c2ccccc2c1C |
| InChI | InChI=1S/C12H12O/c1-8-7-12(13)11-6-4-3-5-10(11)9(8)2/h3-7,13H,1-2H3 |
| InChIKey | KHKLHLMLAHHODS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |