C24H36 — CID 143843330
ethane;2,3,9,10-tetramethylanthracene (PubChem CID 143843330) has the molecular formula C24H36 and a molecular weight of 324.55 g/mol. Its IUPAC name is ethane;2,3,9,10-tetramethylanthracene.
| Compound Name | ethane;2,3,9,10-tetramethylanthracene |
|---|---|
| PubChem CID | 143843330 |
| Molecular Formula | C24H36 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | ethane;2,3,9,10-tetramethylanthracene |
| SMILES | CC.CC.CC.Cc1cc2c(C)c3ccccc3c(C)c2cc1C |
| InChI | InChI=1S/C18H18.3C2H6/c1-11-9-17-13(3)15-7-5-6-8-16(15)14(4)18(17)10-12(11)2;3*1-2/h5-10H,1-4H3;3*1-2H3 |
| InChIKey | XBSKNXICOWLKMK-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|