C14H13NO2 — CID 171715160
3,4-dimethyl-9H-carbazole-1,8-diol (PubChem CID 171715160) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 3,4-dimethyl-9H-carbazole-1,8-diol.
| Compound Name | 3,4-dimethyl-9H-carbazole-1,8-diol |
|---|---|
| PubChem CID | 171715160 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 3,4-dimethyl-9H-carbazole-1,8-diol |
| SMILES | Cc1cc(O)c2[nH]c3c(O)cccc3c2c1C |
| InChI | InChI=1S/C14H13NO2/c1-7-6-11(17)14-12(8(7)2)9-4-3-5-10(16)13(9)15-14/h3-6,15-17H,1-2H3 |
| InChIKey | VSHOZYIIZSUUFW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |