About 8-ethyl-1,4-dimethyl-9H-carbazol-3-amine
8-ethyl-1,4-dimethyl-9H-carbazol-3-amine (PubChem CID 139222915) has the molecular formula C16H18N2
and a molecular weight of 238.33 g/mol. Its IUPAC name is 8-ethyl-1,4-dimethyl-9H-carbazol-3-amine.
Molecular Properties
| Compound Name | 8-ethyl-1,4-dimethyl-9H-carbazol-3-amine |
| PubChem CID | 139222915 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 8-ethyl-1,4-dimethyl-9H-carbazol-3-amine |
| SMILES | CCc1cccc2c1[nH]c1c(C)cc(N)c(C)c12 |
| InChI | InChI=1S/C16H18N2/c1-4-11-6-5-7-12-14-10(3)13(17)8-9(2)15(14)18-16(11)12/h5-8,18H,4,17H2,1-3H3 |
| InChIKey | RJCGSVVRHXDWDL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-ethyl-1,4-dimethyl-9H-carbazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-1,4-dimethyl-9H-carbazol-3-amine?
The IUPAC name of 8-ethyl-1,4-dimethyl-9H-carbazol-3-amine (CID 139222915) is 8-ethyl-1,4-dimethyl-9H-carbazol-3-amine.
What is the SMILES notation for 8-ethyl-1,4-dimethyl-9H-carbazol-3-amine?
The canonical SMILES for 8-ethyl-1,4-dimethyl-9H-carbazol-3-amine is CCc1cccc2c1[nH]c1c(C)cc(N)c(C)c12.
What is the InChIKey of 8-ethyl-1,4-dimethyl-9H-carbazol-3-amine?
The InChIKey is RJCGSVVRHXDWDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2/c1-4-11-6-5-7-12-14-10(3)13(17)8-9(2)15(14)18-16(11)12/h5-8,18H,4,17H2,1-3H3.
What are the key properties of 8-ethyl-1,4-dimethyl-9H-carbazol-3-amine?
8-ethyl-1,4-dimethyl-9H-carbazol-3-amine has a molecular weight of 238.33 g/mol, XLogP of 4.08, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-1,4-dimethyl-9H-carbazol-3-amine is sourced from PubChem (CID 139222915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).