C16H18N2 — CID 139222915
8-ethyl-1,4-dimethyl-9H-carbazol-3-amine (PubChem CID 139222915) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 8-ethyl-1,4-dimethyl-9H-carbazol-3-amine.
| Compound Name | 8-ethyl-1,4-dimethyl-9H-carbazol-3-amine |
|---|---|
| PubChem CID | 139222915 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 8-ethyl-1,4-dimethyl-9H-carbazol-3-amine |
| SMILES | CCc1cccc2c1[nH]c1c(C)cc(N)c(C)c12 |
| InChI | InChI=1S/C16H18N2/c1-4-11-6-5-7-12-14-10(3)13(17)8-9(2)15(14)18-16(11)12/h5-8,18H,4,17H2,1-3H3 |
| InChIKey | RJCGSVVRHXDWDL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|