C14H14N2 — CID 143620519
8-ethyl-3-methyl-9H-pyrido[2,3-b]indole (PubChem CID 143620519) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 8-ethyl-3-methyl-9H-pyrido[2,3-b]indole.
| Compound Name | 8-ethyl-3-methyl-9H-pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 143620519 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 8-ethyl-3-methyl-9H-pyrido[2,3-b]indole |
| SMILES | CCc1cccc2c1[nH]c1ncc(C)cc12 |
| InChI | InChI=1S/C14H14N2/c1-3-10-5-4-6-11-12-7-9(2)8-15-14(12)16-13(10)11/h4-8H,3H2,1-2H3,(H,15,16) |
| InChIKey | AONOBAIPYNNRMS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |