C24H25N3O — CID 143880553
3-(3,8-dimethyl-9H-pyrido[2,3-b]indol-5-yl)-N,N-diethylbenzamide (PubChem CID 143880553) has the molecular formula C24H25N3O and a molecular weight of 371.48 g/mol. Its IUPAC name is 3-(3,8-dimethyl-9H-pyrido[2,3-b]indol-5-yl)-N,N-diethylbenzamide.
| Compound Name | 3-(3,8-dimethyl-9H-pyrido[2,3-b]indol-5-yl)-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 143880553 |
| Molecular Formula | C24H25N3O |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 3-(3,8-dimethyl-9H-pyrido[2,3-b]indol-5-yl)-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(-c2ccc(C)c3[nH]c4ncc(C)cc4c23)c1 |
| InChI | InChI=1S/C24H25N3O/c1-5-27(6-2)24(28)18-9-7-8-17(13-18)19-11-10-16(4)22-21(19)20-12-15(3)14-25-23(20)26-22/h7-14H,5-6H2,1-4H3,(H,25,26) |
| InChIKey | OXWDAKWEASDULW-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |