C37H51N4O6P — CID 67284146
[4-[3-[[5-[3-(cyclopropylcarbamoyl)phenyl]-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-ethylamino]-2,2,5,5-tetramethylhexan-3-yl] dihydrogen phosphate (PubChem CID 67284146) has the molecular formula C37H51N4O6P and a molecular weight of 678.81 g/mol. Its IUPAC name is [4-[3-[[5-[3-(cyclopropylcarbamoyl)phenyl]-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-ethylamino]-2,2,5,5-tetramethylhexan-3-yl] dihydrogen phosphate.
| Compound Name | [4-[3-[[5-[3-(cyclopropylcarbamoyl)phenyl]-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-ethylamino]-2,2,5,5-tetramethylhexan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 67284146 |
| Molecular Formula | C37H51N4O6P |
| Molecular Weight | 678.81 g/mol |
| Exact Mass | 678.35 |
| IUPAC Name | [4-[3-[[5-[3-(cyclopropylcarbamoyl)phenyl]-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-ethylamino]-2,2,5,5-tetramethylhexan-3-yl] dihydrogen phosphate |
| SMILES | CCN(CCCOc1ccc(-c2cccc(C(=O)NC3CC3)c2)c2c1[nH]c1ncc(C)cc12)C(C(OP(=O)(O)O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C37H51N4O6P/c1-9-41(32(36(3,4)5)33(37(6,7)8)47-48(43,44)45)18-11-19-46-29-17-16-27(30-28-20-23(2)22-38-34(28)40-31(29)30)24-12-10-13-25(21-24)35(42)39-26-14-15-26/h10,12-13,16-17,20-22,26,32-33H,9,11,14-15,18-19H2,1-8H3,(H,38,40)(H,39,42)(H2,43,44,45) |
| InChIKey | NXWQWUUERFWJOL-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 137.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.81 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|