C37H53N4O5P — CID 143880546
2-[3-[[5-[3-[(cyclopropylamino)methyl]phenyl]-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-ethylamino]ethyl bis(2-methylpropyl) phosphate (PubChem CID 143880546) has the molecular formula C37H53N4O5P and a molecular weight of 664.83 g/mol. Its IUPAC name is 2-[3-[[5-[3-[(cyclopropylamino)methyl]phenyl]-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-ethylamino]ethyl bis(2-methylpropyl) phosphate.
| Compound Name | 2-[3-[[5-[3-[(cyclopropylamino)methyl]phenyl]-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-ethylamino]ethyl bis(2-methylpropyl) phosphate |
|---|---|
| PubChem CID | 143880546 |
| Molecular Formula | C37H53N4O5P |
| Molecular Weight | 664.83 g/mol |
| Exact Mass | 664.38 |
| IUPAC Name | 2-[3-[[5-[3-[(cyclopropylamino)methyl]phenyl]-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-ethylamino]ethyl bis(2-methylpropyl) phosphate |
| SMILES | CCN(CCCOc1ccc(-c2cccc(CNC3CC3)c2)c2c1[nH]c1ncc(C)cc12)CCOP(=O)(OCC(C)C)OCC(C)C |
| InChI | InChI=1S/C37H53N4O5P/c1-7-41(17-19-44-47(42,45-24-26(2)3)46-25-27(4)5)16-9-18-43-34-15-14-32(30-11-8-10-29(21-30)23-38-31-12-13-31)35-33-20-28(6)22-39-37(33)40-36(34)35/h8,10-11,14-15,20-22,26-27,31,38H,7,9,12-13,16-19,23-25H2,1-6H3,(H,39,40) |
| InChIKey | DXTNERHSLGEMHS-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.83 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|