C29H32N4O2 — CID 141247930
N-cyclopropyl-N-[3-[3-methyl-8-[(1-methylpiperidin-4-yl)methoxy]-9H-pyrido[2,3-b]indol-5-yl]phenyl]formamide (PubChem CID 141247930) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is N-cyclopropyl-N-[3-[3-methyl-8-[(1-methylpiperidin-4-yl)methoxy]-9H-pyrido[2,3-b]indol-5-yl]phenyl]formamide.
| Compound Name | N-cyclopropyl-N-[3-[3-methyl-8-[(1-methylpiperidin-4-yl)methoxy]-9H-pyrido[2,3-b]indol-5-yl]phenyl]formamide |
|---|---|
| PubChem CID | 141247930 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | N-cyclopropyl-N-[3-[3-methyl-8-[(1-methylpiperidin-4-yl)methoxy]-9H-pyrido[2,3-b]indol-5-yl]phenyl]formamide |
| SMILES | Cc1cnc2[nH]c3c(OCC4CCN(C)CC4)ccc(-c4cccc(N(C=O)C5CC5)c4)c3c2c1 |
| InChI | InChI=1S/C29H32N4O2/c1-19-14-25-27-24(21-4-3-5-23(15-21)33(18-34)22-6-7-22)8-9-26(28(27)31-29(25)30-16-19)35-17-20-10-12-32(2)13-11-20/h3-5,8-9,14-16,18,20,22H,6-7,10-13,17H2,1-2H3,(H,30,31) |
| InChIKey | OWXDFNLLGWQARI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|