C22H20N2O2S — CID 143656856
5-(3-cyclopropylsulfinylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole (PubChem CID 143656856) has the molecular formula C22H20N2O2S and a molecular weight of 376.48 g/mol. Its IUPAC name is 5-(3-cyclopropylsulfinylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole.
| Compound Name | 5-(3-cyclopropylsulfinylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 143656856 |
| Molecular Formula | C22H20N2O2S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 5-(3-cyclopropylsulfinylphenyl)-8-methoxy-3-methyl-9H-pyrido[2,3-b]indole |
| SMILES | COc1ccc(-c2cccc(S(=O)C3CC3)c2)c2c1[nH]c1ncc(C)cc12 |
| InChI | InChI=1S/C22H20N2O2S/c1-13-10-18-20-17(8-9-19(26-2)21(20)24-22(18)23-12-13)14-4-3-5-16(11-14)27(25)15-6-7-15/h3-5,8-12,15H,6-7H2,1-2H3,(H,23,24) |
| InChIKey | JAWWDZPNNIFNRR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |