C27H32N2O2S — CID 143880504
8-butoxy-5-(3-cyclopropylsulfinylphenyl)-3-methyl-9H-pyrido[2,3-b]indole;ethane (PubChem CID 143880504) has the molecular formula C27H32N2O2S and a molecular weight of 448.63 g/mol. Its IUPAC name is 8-butoxy-5-(3-cyclopropylsulfinylphenyl)-3-methyl-9H-pyrido[2,3-b]indole;ethane.
| Compound Name | 8-butoxy-5-(3-cyclopropylsulfinylphenyl)-3-methyl-9H-pyrido[2,3-b]indole;ethane |
|---|---|
| PubChem CID | 143880504 |
| Molecular Formula | C27H32N2O2S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 8-butoxy-5-(3-cyclopropylsulfinylphenyl)-3-methyl-9H-pyrido[2,3-b]indole;ethane |
| SMILES | CC.CCCCOc1ccc(-c2cccc(S(=O)C3CC3)c2)c2c1[nH]c1ncc(C)cc12 |
| InChI | InChI=1S/C25H26N2O2S.C2H6/c1-3-4-12-29-22-11-10-20(17-6-5-7-19(14-17)30(28)18-8-9-18)23-21-13-16(2)15-26-25(21)27-24(22)23;1-2/h5-7,10-11,13-15,18H,3-4,8-9,12H2,1-2H3,(H,26,27);1-2H3 |
| InChIKey | CZNVTSPAWJTTLX-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|