About 5-(3-cyclopropylsulfonylphenyl)-3-methyl-8-propoxy-9H-pyrido[2,3-b]indole
5-(3-cyclopropylsulfonylphenyl)-3-methyl-8-propoxy-9H-pyrido[2,3-b]indole (PubChem CID 173115576) has the molecular formula C24H24N2O3S
and a molecular weight of 420.53 g/mol. Its IUPAC name is 5-(3-cyclopropylsulfonylphenyl)-3-methyl-8-propoxy-9H-pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 5-(3-cyclopropylsulfonylphenyl)-3-methyl-8-propoxy-9H-pyrido[2,3-b]indole |
| PubChem CID | 173115576 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 5-(3-cyclopropylsulfonylphenyl)-3-methyl-8-propoxy-9H-pyrido[2,3-b]indole |
| SMILES | CCCOc1ccc(-c2cccc(S(=O)(=O)C3CC3)c2)c2c1[nH]c1ncc(C)cc12 |
| InChI | InChI=1S/C24H24N2O3S/c1-3-11-29-21-10-9-19(22-20-12-15(2)14-25-24(20)26-23(21)22)16-5-4-6-18(13-16)30(27,28)17-7-8-17/h4-6,9-10,12-14,17H,3,7-8,11H2,1-2H3,(H,25,26) |
| InChIKey | HJLTVPGKTPUXKF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-cyclopropylsulfonylphenyl)-3-methyl-8-propoxy-9H-pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-cyclopropylsulfonylphenyl)-3-methyl-8-propoxy-9H-pyrido[2,3-b]indole?
The IUPAC name of 5-(3-cyclopropylsulfonylphenyl)-3-methyl-8-propoxy-9H-pyrido[2,3-b]indole (CID 173115576) is 5-(3-cyclopropylsulfonylphenyl)-3-methyl-8-propoxy-9H-pyrido[2,3-b]indole.
What is the SMILES notation for 5-(3-cyclopropylsulfonylphenyl)-3-methyl-8-propoxy-9H-pyrido[2,3-b]indole?
The canonical SMILES for 5-(3-cyclopropylsulfonylphenyl)-3-methyl-8-propoxy-9H-pyrido[2,3-b]indole is CCCOc1ccc(-c2cccc(S(=O)(=O)C3CC3)c2)c2c1[nH]c1ncc(C)cc12.
What is the InChIKey of 5-(3-cyclopropylsulfonylphenyl)-3-methyl-8-propoxy-9H-pyrido[2,3-b]indole?
The InChIKey is HJLTVPGKTPUXKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N2O3S/c1-3-11-29-21-10-9-19(22-20-12-15(2)14-25-24(20)26-23(21)22)16-5-4-6-18(13-16)30(27,28)17-7-8-17/h4-6,9-10,12-14,17H,3,7-8,11H2,1-2H3,(H,25,26).
What are the key properties of 5-(3-cyclopropylsulfonylphenyl)-3-methyl-8-propoxy-9H-pyrido[2,3-b]indole?
5-(3-cyclopropylsulfonylphenyl)-3-methyl-8-propoxy-9H-pyrido[2,3-b]indole has a molecular weight of 420.53 g/mol, XLogP of 5.42, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-cyclopropylsulfonylphenyl)-3-methyl-8-propoxy-9H-pyrido[2,3-b]indole is sourced from PubChem (CID 173115576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).