C27H34N3O6PS — CID 70925136
2-[ethyl-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl]amino]ethyl dihydrogen phosphite (PubChem CID 70925136) has the molecular formula C27H34N3O6PS and a molecular weight of 559.63 g/mol. Its IUPAC name is 2-[ethyl-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl]amino]ethyl dihydrogen phosphite.
| Compound Name | 2-[ethyl-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl]amino]ethyl dihydrogen phosphite |
|---|---|
| PubChem CID | 70925136 |
| Molecular Formula | C27H34N3O6PS |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 2-[ethyl-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl]amino]ethyl dihydrogen phosphite |
| SMILES | CCN(CCCOc1ccc(-c2cccc(S(=O)(=O)CC)c2)c2c1[nH]c1ncc(C)cc12)CCOP(O)O |
| InChI | InChI=1S/C27H34N3O6PS/c1-4-30(13-15-36-37(31)32)12-7-14-35-24-11-10-22(20-8-6-9-21(17-20)38(33,34)5-2)25-23-16-19(3)18-28-27(23)29-26(24)25/h6,8-11,16-18,31-32H,4-5,7,12-15H2,1-3H3,(H,28,29) |
| InChIKey | HHAOPDGCUHTPTK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 124.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|