C27H31F3N3O7PS — CID 25019567
2-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-(2,2,2-trifluoroethyl)amino]ethyl dihydrogen phosphate (PubChem CID 25019567) has the molecular formula C27H31F3N3O7PS and a molecular weight of 629.59 g/mol. Its IUPAC name is 2-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-(2,2,2-trifluoroethyl)amino]ethyl dihydrogen phosphate.
| Compound Name | 2-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-(2,2,2-trifluoroethyl)amino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 25019567 |
| Molecular Formula | C27H31F3N3O7PS |
| Molecular Weight | 629.59 g/mol |
| Exact Mass | 629.16 |
| IUPAC Name | 2-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-(2,2,2-trifluoroethyl)amino]ethyl dihydrogen phosphate |
| SMILES | CCS(=O)(=O)c1cccc(-c2ccc(OCCCN(CCOP(=O)(O)O)CC(F)(F)F)c3[nH]c4ncc(C)cc4c23)c1 |
| InChI | InChI=1S/C27H31F3N3O7PS/c1-3-42(37,38)20-7-4-6-19(15-20)21-8-9-23(25-24(21)22-14-18(2)16-31-26(22)32-25)39-12-5-10-33(17-27(28,29)30)11-13-40-41(34,35)36/h4,6-9,14-16H,3,5,10-13,17H2,1-2H3,(H,31,32)(H2,34,35,36) |
| InChIKey | QSGHYWAIIMHBRE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 142.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|