C28H28N4O2 — CID 143880436
N-[3-[3-methyl-8-(3-pyridin-3-ylpropoxy)-9H-pyrido[2,3-b]indol-5-yl]phenoxy]ethanamine (PubChem CID 143880436) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is N-[3-[3-methyl-8-(3-pyridin-3-ylpropoxy)-9H-pyrido[2,3-b]indol-5-yl]phenoxy]ethanamine.
| Compound Name | N-[3-[3-methyl-8-(3-pyridin-3-ylpropoxy)-9H-pyrido[2,3-b]indol-5-yl]phenoxy]ethanamine |
|---|---|
| PubChem CID | 143880436 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | N-[3-[3-methyl-8-(3-pyridin-3-ylpropoxy)-9H-pyrido[2,3-b]indol-5-yl]phenoxy]ethanamine |
| SMILES | CCNOc1cccc(-c2ccc(OCCCc3cccnc3)c3[nH]c4ncc(C)cc4c23)c1 |
| InChI | InChI=1S/C28H28N4O2/c1-3-31-34-22-10-4-9-21(16-22)23-11-12-25(33-14-6-8-20-7-5-13-29-18-20)27-26(23)24-15-19(2)17-30-28(24)32-27/h4-5,7,9-13,15-18,31H,3,6,8,14H2,1-2H3,(H,30,32) |
| InChIKey | JLFVFDNUMVCABB-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|