About 2-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]ethyl 2-aminopropanoate
2-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]ethyl 2-aminopropanoate (PubChem CID 66756342) has the molecular formula C25H27N3O5S
and a molecular weight of 481.57 g/mol. Its IUPAC name is 2-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]ethyl 2-aminopropanoate.
Molecular Properties
| Compound Name | 2-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]ethyl 2-aminopropanoate |
| PubChem CID | 66756342 |
| Molecular Formula | C25H27N3O5S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 2-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]ethyl 2-aminopropanoate |
| SMILES | CCS(=O)(=O)c1cccc(-c2ccc(OCCOC(=O)C(C)N)c3[nH]c4ncc(C)cc4c23)c1 |
| InChI | InChI=1S/C25H27N3O5S/c1-4-34(30,31)18-7-5-6-17(13-18)19-8-9-21(32-10-11-33-25(29)16(3)26)23-22(19)20-12-15(2)14-27-24(20)28-23/h5-9,12-14,16H,4,10-11,26H2,1-3H3,(H,27,28) |
| InChIKey | QFOCZASNXQYIGH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]ethyl 2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]ethyl 2-aminopropanoate?
The IUPAC name of 2-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]ethyl 2-aminopropanoate (CID 66756342) is 2-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]ethyl 2-aminopropanoate.
What is the SMILES notation for 2-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]ethyl 2-aminopropanoate?
The canonical SMILES for 2-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]ethyl 2-aminopropanoate is CCS(=O)(=O)c1cccc(-c2ccc(OCCOC(=O)C(C)N)c3[nH]c4ncc(C)cc4c23)c1.
What is the InChIKey of 2-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]ethyl 2-aminopropanoate?
The InChIKey is QFOCZASNXQYIGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N3O5S/c1-4-34(30,31)18-7-5-6-17(13-18)19-8-9-21(32-10-11-33-25(29)16(3)26)23-22(19)20-12-15(2)14-27-24(20)28-23/h5-9,12-14,16H,4,10-11,26H2,1-3H3,(H,27,28).
What are the key properties of 2-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]ethyl 2-aminopropanoate?
2-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]ethyl 2-aminopropanoate has a molecular weight of 481.57 g/mol, XLogP of 3.75, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]ethyl 2-aminopropanoate is sourced from PubChem (CID 66756342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).