C25H29ClN2O2S — CID 143657032
8-butoxy-3-chloro-5-(3-ethylsulfinylphenyl)-9H-pyrido[2,3-b]indole;ethane (PubChem CID 143657032) has the molecular formula C25H29ClN2O2S and a molecular weight of 457.04 g/mol. Its IUPAC name is 8-butoxy-3-chloro-5-(3-ethylsulfinylphenyl)-9H-pyrido[2,3-b]indole;ethane.
| Compound Name | 8-butoxy-3-chloro-5-(3-ethylsulfinylphenyl)-9H-pyrido[2,3-b]indole;ethane |
|---|---|
| PubChem CID | 143657032 |
| Molecular Formula | C25H29ClN2O2S |
| Molecular Weight | 457.04 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 8-butoxy-3-chloro-5-(3-ethylsulfinylphenyl)-9H-pyrido[2,3-b]indole;ethane |
| SMILES | CC.CCCCOc1ccc(-c2cccc(S(=O)CC)c2)c2c1[nH]c1ncc(Cl)cc12 |
| InChI | InChI=1S/C23H23ClN2O2S.C2H6/c1-3-5-11-28-20-10-9-18(15-7-6-8-17(12-15)29(27)4-2)21-19-13-16(24)14-25-23(19)26-22(20)21;1-2/h6-10,12-14H,3-5,11H2,1-2H3,(H,25,26);1-2H3 |
| InChIKey | WQYMDMDNYPATEW-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.04 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|