C23H22N3OP — CID 143443101
N-cyclopropyl-3-(3-methyl-8-methylphosphanyl-9H-pyrido[2,3-b]indol-5-yl)benzamide (PubChem CID 143443101) has the molecular formula C23H22N3OP and a molecular weight of 387.42 g/mol. Its IUPAC name is N-cyclopropyl-3-(3-methyl-8-methylphosphanyl-9H-pyrido[2,3-b]indol-5-yl)benzamide.
| Compound Name | N-cyclopropyl-3-(3-methyl-8-methylphosphanyl-9H-pyrido[2,3-b]indol-5-yl)benzamide |
|---|---|
| PubChem CID | 143443101 |
| Molecular Formula | C23H22N3OP |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N-cyclopropyl-3-(3-methyl-8-methylphosphanyl-9H-pyrido[2,3-b]indol-5-yl)benzamide |
| SMILES | CPc1ccc(-c2cccc(C(=O)NC3CC3)c2)c2c1[nH]c1ncc(C)cc12 |
| InChI | InChI=1S/C23H22N3OP/c1-13-10-18-20-17(8-9-19(28-2)21(20)26-22(18)24-12-13)14-4-3-5-15(11-14)23(27)25-16-6-7-16/h3-5,8-12,16,28H,6-7H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | OQIHOOCKYUVVLP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|