C23H21N3O3S — CID 147733826
3-methyl-5-(3-pyrrolidin-1-ylsulfonylphenyl)-9H-pyrido[2,3-b]indole-8-carbaldehyde (PubChem CID 147733826) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is 3-methyl-5-(3-pyrrolidin-1-ylsulfonylphenyl)-9H-pyrido[2,3-b]indole-8-carbaldehyde.
| Compound Name | 3-methyl-5-(3-pyrrolidin-1-ylsulfonylphenyl)-9H-pyrido[2,3-b]indole-8-carbaldehyde |
|---|---|
| PubChem CID | 147733826 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 3-methyl-5-(3-pyrrolidin-1-ylsulfonylphenyl)-9H-pyrido[2,3-b]indole-8-carbaldehyde |
| SMILES | Cc1cnc2[nH]c3c(C=O)ccc(-c4cccc(S(=O)(=O)N5CCCC5)c4)c3c2c1 |
| InChI | InChI=1S/C23H21N3O3S/c1-15-11-20-21-19(8-7-17(14-27)22(21)25-23(20)24-13-15)16-5-4-6-18(12-16)30(28,29)26-9-2-3-10-26/h4-8,11-14H,2-3,9-10H2,1H3,(H,24,25) |
| InChIKey | GYYNOKCSASQMAK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|