C22H20N2O3S — CID 142694800
5-(3-ethylsulfonylphenyl)-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carbaldehyde (PubChem CID 142694800) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 5-(3-ethylsulfonylphenyl)-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carbaldehyde.
| Compound Name | 5-(3-ethylsulfonylphenyl)-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carbaldehyde |
|---|---|
| PubChem CID | 142694800 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 5-(3-ethylsulfonylphenyl)-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carbaldehyde |
| SMILES | CCS(=O)(=O)c1cccc(-c2cc(C=O)c(C)c3[nH]c4ncc(C)cc4c23)c1 |
| InChI | InChI=1S/C22H20N2O3S/c1-4-28(26,27)17-7-5-6-15(9-17)18-10-16(12-25)14(3)21-20(18)19-8-13(2)11-23-22(19)24-21/h5-12H,4H2,1-3H3,(H,23,24) |
| InChIKey | GVFIMDVHBZGCNT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|