C15H16F2 — CID 143700727
1,8-difluoro-2,3,4,5,6-pentamethylnaphthalene (PubChem CID 143700727) has the molecular formula C15H16F2 and a molecular weight of 234.29 g/mol. Its IUPAC name is 1,8-difluoro-2,3,4,5,6-pentamethylnaphthalene.
| Compound Name | 1,8-difluoro-2,3,4,5,6-pentamethylnaphthalene |
|---|---|
| PubChem CID | 143700727 |
| Molecular Formula | C15H16F2 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1,8-difluoro-2,3,4,5,6-pentamethylnaphthalene |
| SMILES | Cc1cc(F)c2c(F)c(C)c(C)c(C)c2c1C |
| InChI | InChI=1S/C15H16F2/c1-7-6-12(16)14-13(8(7)2)10(4)9(3)11(5)15(14)17/h6H,1-5H3 |
| InChIKey | UTZPFZJWMIKVOH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |