C18H16F2 — CID 132606777
9,10-difluoro-1,2,7,8-tetramethylphenanthrene (PubChem CID 132606777) has the molecular formula C18H16F2 and a molecular weight of 270.32 g/mol. Its IUPAC name is 9,10-difluoro-1,2,7,8-tetramethylphenanthrene.
| Compound Name | 9,10-difluoro-1,2,7,8-tetramethylphenanthrene |
|---|---|
| PubChem CID | 132606777 |
| Molecular Formula | C18H16F2 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 9,10-difluoro-1,2,7,8-tetramethylphenanthrene |
| SMILES | Cc1ccc2c(c1C)c(F)c(F)c1c(C)c(C)ccc12 |
| InChI | InChI=1S/C18H16F2/c1-9-5-7-13-14-8-6-10(2)12(4)16(14)18(20)17(19)15(13)11(9)3/h5-8H,1-4H3 |
| InChIKey | IDMOGQQBRXQYPJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|