C24H28 — CID 145144770
1,2-dimethyltriphenylene;ethane (PubChem CID 145144770) has the molecular formula C24H28 and a molecular weight of 316.49 g/mol. Its IUPAC name is 1,2-dimethyltriphenylene;ethane.
| Compound Name | 1,2-dimethyltriphenylene;ethane |
|---|---|
| PubChem CID | 145144770 |
| Molecular Formula | C24H28 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 1,2-dimethyltriphenylene;ethane |
| SMILES | CC.CC.Cc1ccc2c3ccccc3c3ccccc3c2c1C |
| InChI | InChI=1S/C20H16.2C2H6/c1-13-11-12-19-17-9-4-3-7-15(17)16-8-5-6-10-18(16)20(19)14(13)2;2*1-2/h3-12H,1-2H3;2*1-2H3 |
| InChIKey | IFEUGZMJTUJCQA-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|