C76H60 — CID 159930088
7,8-dimethylfluoranthene;8,9-dimethylfluoranthene;1,2-dimethyltriphenylene;2,3-dimethyltriphenylene (PubChem CID 159930088) has the molecular formula C76H60 and a molecular weight of 973.32 g/mol. Its IUPAC name is 7,8-dimethylfluoranthene;8,9-dimethylfluoranthene;1,2-dimethyltriphenylene;2,3-dimethyltriphenylene.
| Compound Name | 7,8-dimethylfluoranthene;8,9-dimethylfluoranthene;1,2-dimethyltriphenylene;2,3-dimethyltriphenylene |
|---|---|
| PubChem CID | 159930088 |
| Molecular Formula | C76H60 |
| Molecular Weight | 973.32 g/mol |
| Exact Mass | 972.47 |
| IUPAC Name | 7,8-dimethylfluoranthene;8,9-dimethylfluoranthene;1,2-dimethyltriphenylene;2,3-dimethyltriphenylene |
| SMILES | Cc1cc2c(cc1C)-c1cccc3cccc-2c13.Cc1cc2c3ccccc3c3ccccc3c2cc1C.Cc1ccc2c(c1C)-c1cccc3cccc-2c13.Cc1ccc2c3ccccc3c3ccccc3c2c1C |
| InChI | InChI=1S/2C20H16.2C18H14/c1-13-11-19-17-9-5-3-7-15(17)16-8-4-6-10-18(16)20(19)12-14(13)2;1-13-11-12-19-17-9-4-3-7-15(17)16-8-5-6-10-18(16)20(19)14(13)2;1-11-9-16-14-7-3-5-13-6-4-8-15(18(13)14)17(16)10-12(11)2;1-11-9-10-15-14-7-3-5-13-6-4-8-16(18(13)14)17(15)12(11)2/h2*3-12H,1-2H3;2*3-10H,1-2H3 |
| InChIKey | NZNJGBQSEHUAEV-UHFFFAOYSA-N |
| XLogP | 21.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.32 |
| LogP ≤ 5 | 21.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|