C20H16S — CID 150944687
1-methyl-2-methylsulfanyltriphenylene (PubChem CID 150944687) has the molecular formula C20H16S and a molecular weight of 288.42 g/mol. Its IUPAC name is 1-methyl-2-methylsulfanyltriphenylene.
| Compound Name | 1-methyl-2-methylsulfanyltriphenylene |
|---|---|
| PubChem CID | 150944687 |
| Molecular Formula | C20H16S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-methyl-2-methylsulfanyltriphenylene |
| SMILES | CSc1ccc2c3ccccc3c3ccccc3c2c1C |
| InChI | InChI=1S/C20H16S/c1-13-19(21-2)12-11-18-16-9-4-3-7-14(16)15-8-5-6-10-17(15)20(13)18/h3-12H,1-2H3 |
| InChIKey | LIUICXIWJDNOKV-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|