About azane;2-methyl-1,3-bis(methylsulfanyl)benzene
azane;2-methyl-1,3-bis(methylsulfanyl)benzene (PubChem CID 18755719) has the molecular formula C9H18N2S2
and a molecular weight of 218.39 g/mol. Its IUPAC name is azane;2-methyl-1,3-bis(methylsulfanyl)benzene.
Molecular Properties
| Compound Name | azane;2-methyl-1,3-bis(methylsulfanyl)benzene |
| PubChem CID | 18755719 |
| Molecular Formula | C9H18N2S2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | azane;2-methyl-1,3-bis(methylsulfanyl)benzene |
| SMILES | CSc1cccc(SC)c1C.N.N |
| InChI | InChI=1S/C9H12S2.2H3N/c1-7-8(10-2)5-4-6-9(7)11-3;;/h4-6H,1-3H3;2*1H3 |
| InChIKey | VLKQQDBZBCNXNU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;2-methyl-1,3-bis(methylsulfanyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-methyl-1,3-bis(methylsulfanyl)benzene?
The IUPAC name of azane;2-methyl-1,3-bis(methylsulfanyl)benzene (CID 18755719) is azane;2-methyl-1,3-bis(methylsulfanyl)benzene.
What is the SMILES notation for azane;2-methyl-1,3-bis(methylsulfanyl)benzene?
The canonical SMILES for azane;2-methyl-1,3-bis(methylsulfanyl)benzene is CSc1cccc(SC)c1C.N.N.
What is the InChIKey of azane;2-methyl-1,3-bis(methylsulfanyl)benzene?
The InChIKey is VLKQQDBZBCNXNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12S2.2H3N/c1-7-8(10-2)5-4-6-9(7)11-3;;/h4-6H,1-3H3;2*1H3.
What are the key properties of azane;2-methyl-1,3-bis(methylsulfanyl)benzene?
azane;2-methyl-1,3-bis(methylsulfanyl)benzene has a molecular weight of 218.39 g/mol, XLogP of 3.76, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-methyl-1,3-bis(methylsulfanyl)benzene is sourced from PubChem (CID 18755719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).