About CID 68562978
CID 68562978 (PubChem CID 68562978) has the molecular formula C8H12BO2S
and a molecular weight of 183.06 g/mol.
Molecular Properties
| Compound Name | CID 68562978 |
| PubChem CID | 68562978 |
| Molecular Formula | C8H12BO2S |
| Molecular Weight | 183.06 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | — |
| SMILES | CSc1ccccc1C.O[B]O |
| InChI | InChI=1S/C8H10S.BH2O2/c1-7-5-3-4-6-8(7)9-2;2-1-3/h3-6H,1-2H3;2-3H |
| InChIKey | WCQINTOCMPVMCQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.06 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68562978 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68562978?
The IUPAC name of CID 68562978 (CID 68562978) is not available.
What is the SMILES notation for CID 68562978?
The canonical SMILES for CID 68562978 is CSc1ccccc1C.O[B]O.
What is the InChIKey of CID 68562978?
The InChIKey is WCQINTOCMPVMCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10S.BH2O2/c1-7-5-3-4-6-8(7)9-2;2-1-3/h3-6H,1-2H3;2-3H.
What are the key properties of CID 68562978?
CID 68562978 has a molecular weight of 183.06 g/mol, XLogP of 1.22, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68562978 is sourced from PubChem (CID 68562978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).