About (2-methylphenyl) ethanedithioate
(2-methylphenyl) ethanedithioate (PubChem CID 139915930) has the molecular formula C9H10S2
and a molecular weight of 182.31 g/mol. Its IUPAC name is (2-methylphenyl) ethanedithioate.
Molecular Properties
| Compound Name | (2-methylphenyl) ethanedithioate |
| PubChem CID | 139915930 |
| Molecular Formula | C9H10S2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | (2-methylphenyl) ethanedithioate |
| SMILES | CC(=S)Sc1ccccc1C |
| InChI | InChI=1S/C9H10S2/c1-7-5-3-4-6-9(7)11-8(2)10/h3-6H,1-2H3 |
| InChIKey | GOYNFTULWWJOCX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-methylphenyl) ethanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylphenyl) ethanedithioate?
The IUPAC name of (2-methylphenyl) ethanedithioate (CID 139915930) is (2-methylphenyl) ethanedithioate.
What is the SMILES notation for (2-methylphenyl) ethanedithioate?
The canonical SMILES for (2-methylphenyl) ethanedithioate is CC(=S)Sc1ccccc1C.
What is the InChIKey of (2-methylphenyl) ethanedithioate?
The InChIKey is GOYNFTULWWJOCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10S2/c1-7-5-3-4-6-9(7)11-8(2)10/h3-6H,1-2H3.
What are the key properties of (2-methylphenyl) ethanedithioate?
(2-methylphenyl) ethanedithioate has a molecular weight of 182.31 g/mol, XLogP of 3.43, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl) ethanedithioate is sourced from PubChem (CID 139915930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).