C23H22N2S4 — CID 140862897
(2-methylphenyl) N-[[(2-methylphenyl)sulfanylcarbothioylamino]-phenylmethyl]carbamodithioate (PubChem CID 140862897) has the molecular formula C23H22N2S4 and a molecular weight of 454.71 g/mol. Its IUPAC name is (2-methylphenyl) N-[[(2-methylphenyl)sulfanylcarbothioylamino]-phenylmethyl]carbamodithioate.
| Compound Name | (2-methylphenyl) N-[[(2-methylphenyl)sulfanylcarbothioylamino]-phenylmethyl]carbamodithioate |
|---|---|
| PubChem CID | 140862897 |
| Molecular Formula | C23H22N2S4 |
| Molecular Weight | 454.71 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | (2-methylphenyl) N-[[(2-methylphenyl)sulfanylcarbothioylamino]-phenylmethyl]carbamodithioate |
| SMILES | Cc1ccccc1SC(=S)NC(NC(=S)Sc1ccccc1C)c1ccccc1 |
| InChI | InChI=1S/C23H22N2S4/c1-16-10-6-8-14-19(16)28-22(26)24-21(18-12-4-3-5-13-18)25-23(27)29-20-15-9-7-11-17(20)2/h3-15,21H,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | MFCOHMFQSHCXAH-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.71 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|