About ethane;(2-methylphenyl) thiocyanate
ethane;(2-methylphenyl) thiocyanate (PubChem CID 143604497) has the molecular formula C10H13NS
and a molecular weight of 179.29 g/mol. Its IUPAC name is ethane;(2-methylphenyl) thiocyanate.
Molecular Properties
| Compound Name | ethane;(2-methylphenyl) thiocyanate |
| PubChem CID | 143604497 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | ethane;(2-methylphenyl) thiocyanate |
| SMILES | CC.Cc1ccccc1SC#N |
| InChI | InChI=1S/C8H7NS.C2H6/c1-7-4-2-3-5-8(7)10-6-9;1-2/h2-5H,1H3;1-2H3 |
| InChIKey | DNBJAVYYYCHQPF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2-methylphenyl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2-methylphenyl) thiocyanate?
The IUPAC name of ethane;(2-methylphenyl) thiocyanate (CID 143604497) is ethane;(2-methylphenyl) thiocyanate.
What is the SMILES notation for ethane;(2-methylphenyl) thiocyanate?
The canonical SMILES for ethane;(2-methylphenyl) thiocyanate is CC.Cc1ccccc1SC#N.
What is the InChIKey of ethane;(2-methylphenyl) thiocyanate?
The InChIKey is DNBJAVYYYCHQPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS.C2H6/c1-7-4-2-3-5-8(7)10-6-9;1-2/h2-5H,1H3;1-2H3.
What are the key properties of ethane;(2-methylphenyl) thiocyanate?
ethane;(2-methylphenyl) thiocyanate has a molecular weight of 179.29 g/mol, XLogP of 3.59, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2-methylphenyl) thiocyanate is sourced from PubChem (CID 143604497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).