About (2-methylphenyl) N-phenylpropanimidothioate
(2-methylphenyl) N-phenylpropanimidothioate (PubChem CID 143805896) has the molecular formula C16H17NS
and a molecular weight of 255.39 g/mol. Its IUPAC name is (2-methylphenyl) N-phenylpropanimidothioate.
Molecular Properties
| Compound Name | (2-methylphenyl) N-phenylpropanimidothioate |
| PubChem CID | 143805896 |
| Molecular Formula | C16H17NS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (2-methylphenyl) N-phenylpropanimidothioate |
| SMILES | CC/C(=N\c1ccccc1)Sc1ccccc1C |
| InChI | InChI=1S/C16H17NS/c1-3-16(17-14-10-5-4-6-11-14)18-15-12-8-7-9-13(15)2/h4-12H,3H2,1-2H3/b17-16+ |
| InChIKey | YUPJWRWAFOYOBG-WUKNDPDISA-N |
| XLogP | 5.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2-methylphenyl) N-phenylpropanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylphenyl) N-phenylpropanimidothioate?
The IUPAC name of (2-methylphenyl) N-phenylpropanimidothioate (CID 143805896) is (2-methylphenyl) N-phenylpropanimidothioate.
What is the SMILES notation for (2-methylphenyl) N-phenylpropanimidothioate?
The canonical SMILES for (2-methylphenyl) N-phenylpropanimidothioate is CC/C(=N\c1ccccc1)Sc1ccccc1C.
What is the InChIKey of (2-methylphenyl) N-phenylpropanimidothioate?
The InChIKey is YUPJWRWAFOYOBG-WUKNDPDISA-N. The full InChI is InChI=1S/C16H17NS/c1-3-16(17-14-10-5-4-6-11-14)18-15-12-8-7-9-13(15)2/h4-12H,3H2,1-2H3/b17-16+.
What are the key properties of (2-methylphenyl) N-phenylpropanimidothioate?
(2-methylphenyl) N-phenylpropanimidothioate has a molecular weight of 255.39 g/mol, XLogP of 5.23, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl) N-phenylpropanimidothioate is sourced from PubChem (CID 143805896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).