C16H17N — CID 13015455
N,1-diphenylbutan-2-imine (PubChem CID 13015455) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is N,1-diphenylbutan-2-imine.
| Compound Name | N,1-diphenylbutan-2-imine |
|---|---|
| PubChem CID | 13015455 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N,1-diphenylbutan-2-imine |
| SMILES | CC/C(Cc1ccccc1)=N\c1ccccc1 |
| InChI | InChI=1S/C16H17N/c1-2-15(13-14-9-5-3-6-10-14)17-16-11-7-4-8-12-16/h3-12H,2,13H2,1H3/b17-15+ |
| InChIKey | QZEVUCLJTKVPRB-BMRADRMJSA-N |
| XLogP | 4.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|