C9H13F2N — CID 145013768
2,3-difluoro-4-methylaniline;ethane (PubChem CID 145013768) has the molecular formula C9H13F2N and a molecular weight of 173.21 g/mol. Its IUPAC name is 2,3-difluoro-4-methylaniline;ethane.
| Compound Name | 2,3-difluoro-4-methylaniline;ethane |
|---|---|
| PubChem CID | 145013768 |
| Molecular Formula | C9H13F2N |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 2,3-difluoro-4-methylaniline;ethane |
| SMILES | CC.Cc1ccc(N)c(F)c1F |
| InChI | InChI=1S/C7H7F2N.C2H6/c1-4-2-3-5(10)7(9)6(4)8;1-2/h2-3H,10H2,1H3;1-2H3 |
| InChIKey | UMJFGAWCFSQDMQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|