C14H25FN2O — CID 164594407
2-fluoro-4-methylbenzene-1,3-diamine;2,3,3-trimethylbutan-2-ol (PubChem CID 164594407) has the molecular formula C14H25FN2O and a molecular weight of 256.36 g/mol. Its IUPAC name is 2-fluoro-4-methylbenzene-1,3-diamine;2,3,3-trimethylbutan-2-ol.
| Compound Name | 2-fluoro-4-methylbenzene-1,3-diamine;2,3,3-trimethylbutan-2-ol |
|---|---|
| PubChem CID | 164594407 |
| Molecular Formula | C14H25FN2O |
| Molecular Weight | 256.36 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 2-fluoro-4-methylbenzene-1,3-diamine;2,3,3-trimethylbutan-2-ol |
| SMILES | CC(C)(C)C(C)(C)O.Cc1ccc(N)c(F)c1N |
| InChI | InChI=1S/C7H9FN2.C7H16O/c1-4-2-3-5(9)6(8)7(4)10;1-6(2,3)7(4,5)8/h2-3H,9-10H2,1H3;8H,1-5H3 |
| InChIKey | DSPNQQUTBASTJL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|