C9H12FN3 — CID 163404085
(E)-1-(2-amino-6-fluoro-3-methylphenyl)ethene-1,2-diamine (PubChem CID 163404085) has the molecular formula C9H12FN3 and a molecular weight of 181.21 g/mol. Its IUPAC name is (E)-1-(2-amino-6-fluoro-3-methylphenyl)ethene-1,2-diamine.
| Compound Name | (E)-1-(2-amino-6-fluoro-3-methylphenyl)ethene-1,2-diamine |
|---|---|
| PubChem CID | 163404085 |
| Molecular Formula | C9H12FN3 |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | (E)-1-(2-amino-6-fluoro-3-methylphenyl)ethene-1,2-diamine |
| SMILES | Cc1ccc(F)c(/C(N)=C\N)c1N |
| InChI | InChI=1S/C9H12FN3/c1-5-2-3-6(10)8(9(5)13)7(12)4-11/h2-4H,11-13H2,1H3/b7-4+ |
| InChIKey | FVUFDZLLFRUNDE-QPJJXVBHSA-N |
| XLogP | 0.93 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|