About 4-fluoro-3-hydroxy-7,8-dimethylbenzo[c]chromen-6-one
4-fluoro-3-hydroxy-7,8-dimethylbenzo[c]chromen-6-one (PubChem CID 167637191) has the molecular formula C15H11FO3
and a molecular weight of 258.25 g/mol. Its IUPAC name is 4-fluoro-3-hydroxy-7,8-dimethylbenzo[c]chromen-6-one.
Molecular Properties
| Compound Name | 4-fluoro-3-hydroxy-7,8-dimethylbenzo[c]chromen-6-one |
| PubChem CID | 167637191 |
| Molecular Formula | C15H11FO3 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 4-fluoro-3-hydroxy-7,8-dimethylbenzo[c]chromen-6-one |
| SMILES | Cc1ccc2c(c1C)c(=O)oc1c(F)c(O)ccc12 |
| InChI | InChI=1S/C15H11FO3/c1-7-3-4-9-10-5-6-11(17)13(16)14(10)19-15(18)12(9)8(7)2/h3-6,17H,1-2H3 |
| InChIKey | OVXVTHKSHNMEDB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-3-hydroxy-7,8-dimethylbenzo[c]chromen-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3-hydroxy-7,8-dimethylbenzo[c]chromen-6-one?
The IUPAC name of 4-fluoro-3-hydroxy-7,8-dimethylbenzo[c]chromen-6-one (CID 167637191) is 4-fluoro-3-hydroxy-7,8-dimethylbenzo[c]chromen-6-one.
What is the SMILES notation for 4-fluoro-3-hydroxy-7,8-dimethylbenzo[c]chromen-6-one?
The canonical SMILES for 4-fluoro-3-hydroxy-7,8-dimethylbenzo[c]chromen-6-one is Cc1ccc2c(c1C)c(=O)oc1c(F)c(O)ccc12.
What is the InChIKey of 4-fluoro-3-hydroxy-7,8-dimethylbenzo[c]chromen-6-one?
The InChIKey is OVXVTHKSHNMEDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11FO3/c1-7-3-4-9-10-5-6-11(17)13(16)14(10)19-15(18)12(9)8(7)2/h3-6,17H,1-2H3.
What are the key properties of 4-fluoro-3-hydroxy-7,8-dimethylbenzo[c]chromen-6-one?
4-fluoro-3-hydroxy-7,8-dimethylbenzo[c]chromen-6-one has a molecular weight of 258.25 g/mol, XLogP of 3.41, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-hydroxy-7,8-dimethylbenzo[c]chromen-6-one is sourced from PubChem (CID 167637191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).