C16H16N2 — CID 150787819
1,2,7,8-tetramethylbenzo[c][1,8]naphthyridine (PubChem CID 150787819) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 1,2,7,8-tetramethylbenzo[c][1,8]naphthyridine.
| Compound Name | 1,2,7,8-tetramethylbenzo[c][1,8]naphthyridine |
|---|---|
| PubChem CID | 150787819 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1,2,7,8-tetramethylbenzo[c][1,8]naphthyridine |
| SMILES | Cc1ccc2c(cnc3ncc(C)c(C)c32)c1C |
| InChI | InChI=1S/C16H16N2/c1-9-5-6-13-14(11(9)3)8-18-16-15(13)12(4)10(2)7-17-16/h5-8H,1-4H3 |
| InChIKey | KDFLCVDUHXSQHN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|