C11H12S — CID 54060383
2,4,5-trimethyl-1-benzothiophene (PubChem CID 54060383) has the molecular formula C11H12S and a molecular weight of 176.28 g/mol. Its IUPAC name is 2,4,5-trimethyl-1-benzothiophene.
| Compound Name | 2,4,5-trimethyl-1-benzothiophene |
|---|---|
| PubChem CID | 54060383 |
| Molecular Formula | C11H12S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 2,4,5-trimethyl-1-benzothiophene |
| SMILES | Cc1cc2c(C)c(C)ccc2s1 |
| InChI | InChI=1S/C11H12S/c1-7-4-5-11-10(9(7)3)6-8(2)12-11/h4-6H,1-3H3 |
| InChIKey | LZHFMMVHBUIWEM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |