C11H12OS — CID 131190841
(4,5-dimethyl-1-benzothiophen-2-yl)methanol (PubChem CID 131190841) has the molecular formula C11H12OS and a molecular weight of 192.28 g/mol. Its IUPAC name is (4,5-dimethyl-1-benzothiophen-2-yl)methanol.
| Compound Name | (4,5-dimethyl-1-benzothiophen-2-yl)methanol |
|---|---|
| PubChem CID | 131190841 |
| Molecular Formula | C11H12OS |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (4,5-dimethyl-1-benzothiophen-2-yl)methanol |
| SMILES | Cc1ccc2sc(CO)cc2c1C |
| InChI | InChI=1S/C11H12OS/c1-7-3-4-11-10(8(7)2)5-9(6-12)13-11/h3-5,12H,6H2,1-2H3 |
| InChIKey | DPNVSIVHPIQEPG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |