C10H14S2 — CID 144533203
2,5-dimethylthieno[3,2-b]thiophene;ethane (PubChem CID 144533203) has the molecular formula C10H14S2 and a molecular weight of 198.36 g/mol. Its IUPAC name is 2,5-dimethylthieno[3,2-b]thiophene;ethane.
| Compound Name | 2,5-dimethylthieno[3,2-b]thiophene;ethane |
|---|---|
| PubChem CID | 144533203 |
| Molecular Formula | C10H14S2 |
| Molecular Weight | 198.36 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2,5-dimethylthieno[3,2-b]thiophene;ethane |
| SMILES | CC.Cc1cc2sc(C)cc2s1 |
| InChI | InChI=1S/C8H8S2.C2H6/c1-5-3-7-8(9-5)4-6(2)10-7;1-2/h3-4H,1-2H3;1-2H3 |
| InChIKey | SVANMIVJQUNZRD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |