C6H5NS2 — CID 163647601
5-methylthieno[2,3-d][1,2]thiazole (PubChem CID 163647601) has the molecular formula C6H5NS2 and a molecular weight of 155.25 g/mol. Its IUPAC name is 5-methylthieno[2,3-d][1,2]thiazole.
| Compound Name | 5-methylthieno[2,3-d][1,2]thiazole |
|---|---|
| PubChem CID | 163647601 |
| Molecular Formula | C6H5NS2 |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 154.99 |
| IUPAC Name | 5-methylthieno[2,3-d][1,2]thiazole |
| SMILES | Cc1cc2sncc2s1 |
| InChI | InChI=1S/C6H5NS2/c1-4-2-5-6(8-4)3-7-9-5/h2-3H,1H3 |
| InChIKey | IJOVPVNXNAXJRR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |