C9H12S2 — CID 91311898
ethane;5-methylthieno[3,2-b]thiophene (PubChem CID 91311898) has the molecular formula C9H12S2 and a molecular weight of 184.33 g/mol. Its IUPAC name is ethane;5-methylthieno[3,2-b]thiophene.
| Compound Name | ethane;5-methylthieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 91311898 |
| Molecular Formula | C9H12S2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | ethane;5-methylthieno[3,2-b]thiophene |
| SMILES | CC.Cc1cc2sccc2s1 |
| InChI | InChI=1S/C7H6S2.C2H6/c1-5-4-7-6(9-5)2-3-8-7;1-2/h2-4H,1H3;1-2H3 |
| InChIKey | CTZGTPYJBWYNIB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |